EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H18O5 |
| Net Charge | 0 |
| Average Mass | 338.359 |
| Monoisotopic Mass | 338.11542 |
| SMILES | CC(=O)OCCCc1ccc2oc(-c3ccc4c(c3)OCO4)cc2c1 |
| InChI | InChI=1S/C20H18O5/c1-13(21)22-8-2-3-14-4-6-17-16(9-14)11-19(25-17)15-5-7-18-20(10-15)24-12-23-18/h4-7,9-11H,2-3,8,12H2,1H3 |
| InChIKey | IYUKVCGRCMQIPB-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Styrax agrestis (ncbitaxon:153522) | ripe fruit (PO:0007038) | PubMed (21939219) | Dried, powdered fruits were extracted with ethylacetate. |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-demethoxylegonol acetate (CHEBI:69552) has functional parent egonol acetate (CHEBI:69556) |
| 7-demethoxylegonol acetate (CHEBI:69552) has parent hydride 1-benzofuran (CHEBI:35260) |
| 7-demethoxylegonol acetate (CHEBI:69552) has role plant metabolite (CHEBI:76924) |
| 7-demethoxylegonol acetate (CHEBI:69552) is a 1-benzofurans (CHEBI:38830) |
| 7-demethoxylegonol acetate (CHEBI:69552) is a acetate ester (CHEBI:47622) |
| 7-demethoxylegonol acetate (CHEBI:69552) is a benzodioxoles (CHEBI:38298) |
| IUPAC Name |
|---|
| 3-[2-(1,3-benzodioxol-5-yl)-1-benzofuran-5-yl]propyl acetate |
| Synonym | Source |
|---|---|
| 5-(3-acetoxypropyl)-2-(3,4-methylenedioxyphenyl)benzofuran | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10370893 | Reaxys |
| Citations |
|---|