EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H43NO |
| Net Charge | 0 |
| Average Mass | 337.592 |
| Monoisotopic Mass | 337.33446 |
| SMILES | CCCCCCCCCCCCCCC/C=C\CCCCC(N)=O |
| InChI | InChI=1S/C22H43NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24/h16-17H,2-15,18-21H2,1H3,(H2,23,24)/b17-16- |
| InChIKey | COUPDYRANTUKKV-MSUUIHNZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rubia yunnanensis (IPNI:765385-1) | root (BTO:0001188) | PubMed (21973054) | Methanolic extract of air dried powdered roots. |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-cis-Docosenamide (CHEBI:69545) has role metabolite (CHEBI:25212) |
| 6-cis-Docosenamide (CHEBI:69545) is a primary fatty amide (CHEBI:143129) |
| Citations |
|---|