EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H22O7 |
| Net Charge | 0 |
| Average Mass | 374.389 |
| Monoisotopic Mass | 374.13655 |
| SMILES | COc1cc(C(=O)[C@H]2CO[C@H](c3ccc(O)c(OC)c3)[C@H]2CO)ccc1O |
| InChI | InChI=1S/C20H22O7/c1-25-17-7-11(3-5-15(17)22)19(24)14-10-27-20(13(14)9-21)12-4-6-16(23)18(8-12)26-2/h3-8,13-14,20-23H,9-10H2,1-2H3/t13-,14-,20+/m0/s1 |
| InChIKey | RWAKIPFJHIOZAN-PJSUUKDQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rubia yunnanensis (IPNI:765385-1) | root (BTO:0001188) | PubMed (21973054) | Methanolic extract of air dried powdered roots. |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vladinol D (CHEBI:69543) has role plant metabolite (CHEBI:76924) |
| vladinol D (CHEBI:69543) is a aromatic ketone (CHEBI:76224) |
| vladinol D (CHEBI:69543) is a guaiacols (CHEBI:134251) |
| vladinol D (CHEBI:69543) is a lignan (CHEBI:25036) |
| vladinol D (CHEBI:69543) is a oxolanes (CHEBI:26912) |
| vladinol D (CHEBI:69543) is a polyphenol (CHEBI:26195) |
| vladinol D (CHEBI:69543) is a primary alcohol (CHEBI:15734) |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15775152 | Reaxys |
| Citations |
|---|