EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H24O6 |
| Net Charge | 0 |
| Average Mass | 360.406 |
| Monoisotopic Mass | 360.15729 |
| SMILES | COc1cc([C@H]2c3cc(O)c(OC)cc3C[C@@H](CO)[C@@H]2CO)ccc1O |
| InChI | InChI=1S/C20H24O6/c1-25-18-6-11(3-4-16(18)23)20-14-8-17(24)19(26-2)7-12(14)5-13(9-21)15(20)10-22/h3-4,6-8,13,15,20-24H,5,9-10H2,1-2H3/t13-,15-,20-/m0/s1 |
| InChIKey | OGFXBIXJCWAUCH-KPHUOKFYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rubia yunnanensis (IPNI:765385-1) | root (BTO:0001188) | PubMed (21973054) | Methanolic extract of air dried powdered roots. |
| Taxus yunnanensis (ncbitaxon:147275) | xylem (BTO:0001468) | PubMed (21138310) | Previous component: wood; Aqueous extract of air-dried, powdered wood |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-isolariciresinol (CHEBI:69542) has role plant metabolite (CHEBI:76924) |
| (+)-isolariciresinol (CHEBI:69542) is a guaiacols (CHEBI:134251) |
| (+)-isolariciresinol (CHEBI:69542) is a lignan (CHEBI:25036) |
| (+)-isolariciresinol (CHEBI:69542) is a polyphenol (CHEBI:26195) |
| (+)-isolariciresinol (CHEBI:69542) is a primary alcohol (CHEBI:15734) |
| IUPAC Name |
|---|
| (6R,7R,8S)-8-(4-hydroxy-3-methoxyphenyl)-6,7-bis(hydroxymethyl)-3-methoxy-5,6,7,8-tetrahydronaphthalen-2-ol |
| Synonym | Source |
|---|---|
| 1,2,3,4-tetrahydro-7-hydroxy-1-(4-hydroxy-3-methoxyphenyl)-6-methoxy-2,3-naphthalenedimethanol | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2019804 | Reaxys |
| CAS:548-29-8 | ChemIDplus |
| Citations |
|---|