EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H10Cl4 |
| Net Charge | 0 |
| Average Mass | 320.046 |
| Monoisotopic Mass | 317.95366 |
| SMILES | Clc1ccc(C(c2ccccc2Cl)C(Cl)Cl)cc1 |
| InChI | InChI=1S/C14H10Cl4/c15-10-7-5-9(6-8-10)13(14(17)18)11-3-1-2-4-12(11)16/h1-8,13-14H |
| InChIKey | JWBOIMRXGHLCPP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Mitotane (CHEBI:6954) has role antineoplastic agent (CHEBI:35610) |
| Mitotane (CHEBI:6954) is a diarylmethane (CHEBI:51614) |
| INN | Source |
|---|---|
| mitotano | WHO MedNet |
| Synonyms | Source |
|---|---|
| CB 313 | ChEMBL |
| CB-313 | ChEMBL |
| chloditan | DrugCentral |
| chlodithane | DrugCentral |
| lysodren | DrugCentral |
| Lysodren (TN) | KEGG COMPOUND |
| Brand Name | Source |
|---|---|
| Opddd | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 1820 | DrugCentral |
| D00420 | KEGG DRUG |
| HMDB0014786 | HMDB |
| LSM-1451 | LINCS |
| Registry Numbers | Sources |
|---|---|
| CAS:53-19-0 | DrugCentral |
| CAS:53-19-0 | KEGG COMPOUND |
| Citations |
|---|