EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H10O4 |
| Net Charge | 0 |
| Average Mass | 266.252 |
| Monoisotopic Mass | 266.05791 |
| SMILES | COC(=O)c1ccc2c(c1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C16H10O4/c1-20-16(19)9-6-7-12-13(8-9)15(18)11-5-3-2-4-10(11)14(12)17/h2-8H,1H3 |
| InChIKey | JJFLSBOGTGPZMM-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rubia yunnanensis (IPNI:765385-1) | root (BTO:0001188) | PubMed (21973054) | Methanolic extract of air dried powdered roots. |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-carbomethoxy-9,10-anthraquinone (CHEBI:69535) has role plant metabolite (CHEBI:76924) |
| 2-carbomethoxy-9,10-anthraquinone (CHEBI:69535) is a anthraquinone (CHEBI:22580) |
| 2-carbomethoxy-9,10-anthraquinone (CHEBI:69535) is a aromatic ester (CHEBI:62732) |
| 2-carbomethoxy-9,10-anthraquinone (CHEBI:69535) is a methyl ester (CHEBI:25248) |
| IUPAC Name |
|---|
| methyl 9,10-dioxo-9,10-dihydroanthracene-2-carboxylate |
| Synonyms | Source |
|---|---|
| 2-(methoxycarbonyl)-9,10-anthraquinone | ChEBI |
| 9,10-dioxo-9,10-dihydro-anthracene-2-carboxylic acid methyl ester | ChEBI |
| methyl 9,10-dihydro-9,10-dioxoanthracene-2-carboxylate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2698561 | Reaxys |
| Citations |
|---|