EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H10O3 |
| Net Charge | 0 |
| Average Mass | 238.242 |
| Monoisotopic Mass | 238.06299 |
| SMILES | Cc1ccc2c(c1O)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C15H10O3/c1-8-6-7-11-12(13(8)16)15(18)10-5-3-2-4-9(10)14(11)17/h2-7,16H,1H3 |
| InChIKey | CZODYZFOLUNSFR-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rubia yunnanensis (IPNI:765385-1) | root (BTO:0001188) | PubMed (21973054) | Methanolic extract of air dried powdered roots. |
| Streptocarpus dunnii (ncbitaxon:121487) | - | PubMed (21174407) | Isolated from n-hexane extract of in vitro cultures of Streptocarpus dunnii |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-hydroxy-2-methyl-9,10-anthraquinone (CHEBI:69534) has role plant metabolite (CHEBI:76924) |
| 1-hydroxy-2-methyl-9,10-anthraquinone (CHEBI:69534) is a monohydroxyanthraquinone (CHEBI:37483) |
| IUPAC Name |
|---|
| 1-hydroxy-2-methylanthracene-9,10-dione |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2053617 | Reaxys |
| CAS:6268-09-3 | ChemIDplus |
| Citations |
|---|