EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H10O4 |
| Net Charge | 0 |
| Average Mass | 254.241 |
| Monoisotopic Mass | 254.05791 |
| SMILES | Cc1c(O)cc2c(c1O)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C15H10O4/c1-7-11(16)6-10-12(13(7)17)15(19)9-5-3-2-4-8(9)14(10)18/h2-6,16-17H,1H3 |
| InChIKey | IRZTUXPRIUZXMP-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rubia yunnanensis (IPNI:765385-1) | root (BTO:0001188) | PubMed (21973054) | Methanolic extract of air dried powdered roots. |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Application: | hepatoprotective agent Any compound that is able to prevent damage to the liver. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rubiadin (CHEBI:69533) has role antibacterial agent (CHEBI:33282) |
| rubiadin (CHEBI:69533) has role antioxidant (CHEBI:22586) |
| rubiadin (CHEBI:69533) has role hepatoprotective agent (CHEBI:62868) |
| rubiadin (CHEBI:69533) has role plant metabolite (CHEBI:76924) |
| rubiadin (CHEBI:69533) is a dihydroxyanthraquinone (CHEBI:37484) |
| IUPAC Name |
|---|
| 1,3-dihydroxy-2-methylanthracene-9,10-dione |
| Manual Xrefs | Databases |
|---|---|
| C00002862 | KNApSAcK |
| C10402 | KEGG COMPOUND |
| KR20120033699 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1885558 | Reaxys |
| CAS:117-02-2 | KEGG COMPOUND |
| CAS:117-02-2 | ChemIDplus |
| Citations |
|---|