EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H10O4 |
| Net Charge | 0 |
| Average Mass | 254.241 |
| Monoisotopic Mass | 254.05791 |
| SMILES | Cc1ccc2c(c1O)C(=O)c1ccc(O)cc1C2=O |
| InChI | InChI=1S/C15H10O4/c1-7-2-4-10-12(13(7)17)15(19)9-5-3-8(16)6-11(9)14(10)18/h2-6,16-17H,1H3 |
| InChIKey | BSKQISPKMLYNTK-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rubia yunnanensis (IPNI:765385-1) | root (BTO:0001188) | PubMed (21973054) | Methanolic extract of air dried powdered roots. |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,6-dihydroxy-2-methyl-9,10-anthraquinone (CHEBI:69532) has role antibacterial agent (CHEBI:33282) |
| 1,6-dihydroxy-2-methyl-9,10-anthraquinone (CHEBI:69532) has role plant metabolite (CHEBI:76924) |
| 1,6-dihydroxy-2-methyl-9,10-anthraquinone (CHEBI:69532) is a dihydroxyanthraquinone (CHEBI:37484) |
| IUPAC Name |
|---|
| 1,6-dihydroxy-2-methylanthracene-9,10-dione |
| Synonym | Source |
|---|---|
| Soranjidiol | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2382285 | Reaxys |
| CAS:518-73-0 | ChemIDplus |
| Citations |
|---|