EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H12O5 |
| Net Charge | 0 |
| Average Mass | 284.267 |
| Monoisotopic Mass | 284.06847 |
| SMILES | COc1c(C)c(O)cc2c1C(=O)c1ccc(O)cc1C2=O |
| InChI | InChI=1S/C16H12O5/c1-7-12(18)6-11-13(16(7)21-2)15(20)9-4-3-8(17)5-10(9)14(11)19/h3-6,17-18H,1-2H3 |
| InChIKey | FDRWSVGPMGRFGX-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rubia yunnanensis (IPNI:765385-1) | root (BTO:0001188) | PubMed (21973054) | Methanolic extract of air dried powdered roots. |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rubianthraquinone (CHEBI:69531) has role plant metabolite (CHEBI:76924) |
| rubianthraquinone (CHEBI:69531) is a aromatic ether (CHEBI:35618) |
| rubianthraquinone (CHEBI:69531) is a dihydroxyanthraquinone (CHEBI:37484) |
| IUPAC Name |
|---|
| 3,6-dihydroxy-1-methoxy-2-methylanthracene-9,10-dione |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9422642 | Reaxys |
| Citations |
|---|