EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H48O |
| Net Charge | 0 |
| Average Mass | 424.713 |
| Monoisotopic Mass | 424.37052 |
| SMILES | [H][C@@]12CC[C@]3([H])C(=CC[C@@]4(C)[C@@]3(C)CC[C@]4([H])[C@H](C)CCC=C(C)C)[C@@]1(C)CCC(=O)C2(C)C |
| InChI | InChI=1S/C30H48O/c1-20(2)10-9-11-21(3)22-14-18-30(8)24-12-13-25-27(4,5)26(31)16-17-28(25,6)23(24)15-19-29(22,30)7/h10,15,21-22,24-25H,9,11-14,16-19H2,1-8H3/t21-,22-,24-,25+,28-,29-,30+/m1/s1 |
| InChIKey | LKHNRKZLWGLUOW-GKPUGJDGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rubia yunnanensis (IPNI:765385-1) | root (BTO:0001188) | PubMed (21973054) | Methanolic extract of air dried powdered roots. |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lanosta-9(11),24-dien-3-one (CHEBI:69530) has parent hydride lanostane (CHEBI:20265) |
| lanosta-9(11),24-dien-3-one (CHEBI:69530) has role plant metabolite (CHEBI:76924) |
| lanosta-9(11),24-dien-3-one (CHEBI:69530) is a cyclic terpene ketone (CHEBI:36130) |
| lanosta-9(11),24-dien-3-one (CHEBI:69530) is a tetracyclic triterpenoid (CHEBI:26893) |
| IUPAC Name |
|---|
| lanosta-9(11),24-dien-3-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22020809 | Reaxys |
| Citations |
|---|