EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H48O4 |
| Net Charge | 0 |
| Average Mass | 472.710 |
| Monoisotopic Mass | 472.35526 |
| SMILES | [H][C@]12[C@H](O)C[C@@H](C(C)C)[C@]1(CO)CC[C@]1(C)[C@]2(C)CC=C2[C@@]1([H])[C@@H](O)C[C@@]1([H])C(C)(C)C(=O)CC[C@]21C |
| InChI | InChI=1S/C30H48O4/c1-17(2)19-14-21(33)25-29(7)11-8-18-24(28(29,6)12-13-30(19,25)16-31)20(32)15-22-26(3,4)23(34)9-10-27(18,22)5/h8,17,19-22,24-25,31-33H,9-16H2,1-7H3/t19-,20-,21+,22-,24-,25+,27+,28-,29+,30+/m0/s1 |
| InChIKey | BNCWPGHWXAEYNK-MEKJSECDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rubia yunnanensis (IPNI:765385-1) | root (BTO:0001188) | PubMed (21973054) | Methanolic extract of air dried powdered roots. |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rubiarbonone B (CHEBI:69526) has role plant metabolite (CHEBI:76924) |
| rubiarbonone B (CHEBI:69526) is a cyclic terpene ketone (CHEBI:36130) |
| rubiarbonone B (CHEBI:69526) is a pentacyclic triterpenoid (CHEBI:25872) |
| rubiarbonone B (CHEBI:69526) is a triol (CHEBI:27136) |
| IUPAC Name |
|---|
| (1R,3S,3aR,5aS,5bS,6S,7aR,11aS,13aR,13bR)-1,6-dihydroxy-3a-(hydroxymethyl)-5a,8,8,11a,13a-pentamethyl-3-(propan-2-yl)-1,2,3,3a,4,5,5a,5b,6,7,7a,8,10,11,11a,13,13a,13b-octadecahydro-9H-cyclopenta[a]chrysen-9-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9306367 | Reaxys |
| Citations |
|---|