EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H8O3 |
| Net Charge | 0 |
| Average Mass | 188.182 |
| Monoisotopic Mass | 188.04734 |
| SMILES | COC1=CC(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C11H8O3/c1-14-10-6-9(12)7-4-2-3-5-8(7)11(10)13/h2-6H,1H3 |
| InChIKey | OBGBGHKYJAOXRR-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rubia yunnanensis (IPNI:765385-1) | root (BTO:0001188) | PubMed (21973054) | Methanolic extract of air dried powdered roots. |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-methoxy-1,4-naphthoquinone (CHEBI:69522) has role antimicrobial agent (CHEBI:33281) |
| 2-methoxy-1,4-naphthoquinone (CHEBI:69522) has role metabolite (CHEBI:25212) |
| 2-methoxy-1,4-naphthoquinone (CHEBI:69522) has role plant metabolite (CHEBI:76924) |
| 2-methoxy-1,4-naphthoquinone (CHEBI:69522) is a 1,4-naphthoquinones (CHEBI:132142) |
| 2-methoxy-1,4-naphthoquinone (CHEBI:69522) is a enol ether (CHEBI:47985) |
| IUPAC Name |
|---|
| 2-methoxynaphthalene-1,4-dione |
| Synonym | Source |
|---|---|
| 2-Methoxy-p-naphthoquinone | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2046314 | Reaxys |
| CAS:2348-82-5 | ChemIDplus |
| Citations |
|---|