EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H8O3 |
| Net Charge | 0 |
| Average Mass | 188.182 |
| Monoisotopic Mass | 188.04734 |
| SMILES | COC1=CC(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C11H8O3/c1-14-10-6-9(12)7-4-2-3-5-8(7)11(10)13/h2-6H,1H3 |
| InChIKey | OBGBGHKYJAOXRR-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rubia yunnanensis (IPNI:765385-1) | root (BTO:0001188) | PubMed (21973054) | Methanolic extract of air dried powdered roots. |
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-methoxy-1,4-naphthoquinone (CHEBI:69522) has role antimicrobial agent (CHEBI:33281) |
| 2-methoxy-1,4-naphthoquinone (CHEBI:69522) has role metabolite (CHEBI:25212) |
| 2-methoxy-1,4-naphthoquinone (CHEBI:69522) has role plant metabolite (CHEBI:76924) |
| 2-methoxy-1,4-naphthoquinone (CHEBI:69522) is a 1,4-naphthoquinones (CHEBI:132142) |
| 2-methoxy-1,4-naphthoquinone (CHEBI:69522) is a enol ether (CHEBI:47985) |
| IUPAC Name |
|---|
| 2-methoxynaphthalene-1,4-dione |
| Synonym | Source |
|---|---|
| 2-Methoxy-p-naphthoquinone | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2046314 | Reaxys |
| CAS:2348-82-5 | ChemIDplus |
| Citations |
|---|