EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H10O4 |
| Net Charge | 0 |
| Average Mass | 254.241 |
| Monoisotopic Mass | 254.05791 |
| SMILES | O=C1c2ccccc2C(=O)c2cc(CO)c(O)cc21 |
| InChI | InChI=1S/C15H10O4/c16-7-8-5-11-12(6-13(8)17)15(19)10-4-2-1-3-9(10)14(11)18/h1-6,16-17H,7H2 |
| InChIKey | LMXDYBJTJGPZPD-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rubia yunnanensis (IPNI:765385-1) | root (BTO:0001188) | PubMed (21973054) | Methanolic extract of air dried powdered roots. |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-hydroxy-2-hydroxymethyl-9,10-anthraquinone (CHEBI:69520) has role antineoplastic agent (CHEBI:35610) |
| 3-hydroxy-2-hydroxymethyl-9,10-anthraquinone (CHEBI:69520) has role plant metabolite (CHEBI:76924) |
| 3-hydroxy-2-hydroxymethyl-9,10-anthraquinone (CHEBI:69520) is a monohydroxyanthraquinone (CHEBI:37483) |
| 3-hydroxy-2-hydroxymethyl-9,10-anthraquinone (CHEBI:69520) is a primary alcohol (CHEBI:15734) |
| IUPAC Name |
|---|
| 2-hydroxy-3-(hydroxymethyl)anthracene-9,10-dione |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1988488 | Reaxys |
| Citations |
|---|