EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H18O4 |
| Net Charge | 0 |
| Average Mass | 322.360 |
| Monoisotopic Mass | 322.12051 |
| SMILES | [H][C@]1([C@@]2([H])C[C@@H](O)c3ccccc3C2=O)C[C@@H](O)c2ccccc2C1=O |
| InChI | InChI=1S/C20H18O4/c21-17-9-15(19(23)13-7-3-1-5-11(13)17)16-10-18(22)12-6-2-4-8-14(12)20(16)24/h1-8,15-18,21-22H,9-10H2/t15-,16-,17-,18-/m1/s1 |
| InChIKey | KXYYQTOKRSUJFQ-BRSBDYLESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rubia yunnanensis (IPNI:765385-1) | root (BTO:0001188) | PubMed (21973054) | Methanolic extract of air dried powdered roots. |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2R,2'R,4R,4'R)-4,4'-dihydroxy-3,3',4,4'-tetrahydro-2,2'-binaphthalene-1,1'(2H,2'H)-dione (CHEBI:69515) has role plant metabolite (CHEBI:76924) |
| (2R,2'R,4R,4'R)-4,4'-dihydroxy-3,3',4,4'-tetrahydro-2,2'-binaphthalene-1,1'(2H,2'H)-dione (CHEBI:69515) is a cyclic ketone (CHEBI:3992) |
| (2R,2'R,4R,4'R)-4,4'-dihydroxy-3,3',4,4'-tetrahydro-2,2'-binaphthalene-1,1'(2H,2'H)-dione (CHEBI:69515) is a ring assembly (CHEBI:36820) |
| (2R,2'R,4R,4'R)-4,4'-dihydroxy-3,3',4,4'-tetrahydro-2,2'-binaphthalene-1,1'(2H,2'H)-dione (CHEBI:69515) is a secondary alcohol (CHEBI:35681) |
| (2R,2'R,4R,4'R)-4,4'-dihydroxy-3,3',4,4'-tetrahydro-2,2'-binaphthalene-1,1'(2H,2'H)-dione (CHEBI:69515) is a tetralins (CHEBI:36786) |
| IUPAC Name |
|---|
| (2R,2'R,4R,4'R)-4,4'-dihydroxy-3,3',4,4'-tetrahydro-2,2'-binaphthalene-1,1'(2H,2'H)-dione |
| Synonym | Source |
|---|---|
| (4RS,4'RS)-dihydroxy-(2RS,2'RS)-binaphthalene-1,1'-dione | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22020806 | Reaxys |
| Citations |
|---|