EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H20O9 |
| Net Charge | 0 |
| Average Mass | 380.349 |
| Monoisotopic Mass | 380.11073 |
| SMILES | COC(=O)c1cc(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)c2ccccc2c1O |
| InChI | InChI=1S/C18H20O9/c1-25-17(24)10-6-11(8-4-2-3-5-9(8)13(10)20)26-18-16(23)15(22)14(21)12(7-19)27-18/h2-6,12,14-16,18-23H,7H2,1H3/t12-,14-,15+,16-,18-/m1/s1 |
| InChIKey | ZZJSOQXSWDNDJW-AEWXESQOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rubia yunnanensis (IPNI:765385-1) | root (BTO:0001188) | PubMed (21973054) | Methanolic extract of air dried powdered roots. |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rubinaphthin A methyl ester (CHEBI:69514) has role metabolite (CHEBI:25212) |
| rubinaphthin A methyl ester (CHEBI:69514) has role plant metabolite (CHEBI:76924) |
| rubinaphthin A methyl ester (CHEBI:69514) is a aromatic ester (CHEBI:62732) |
| rubinaphthin A methyl ester (CHEBI:69514) is a monosaccharide derivative (CHEBI:63367) |
| rubinaphthin A methyl ester (CHEBI:69514) is a naphthols (CHEBI:25392) |
| rubinaphthin A methyl ester (CHEBI:69514) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| methyl 4-(β-D-glucopyranosyloxy)-1-hydroxynaphthalene-2-carboxylate |
| Synonym | Source |
|---|---|
| 2-carbomethoxy-1,4-naphthohydroquinone-4-O-β-D-glucopyranoside | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22020808 | Reaxys |
| Citations |
|---|