EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H46O5 |
| Net Charge | 0 |
| Average Mass | 486.693 |
| Monoisotopic Mass | 486.33452 |
| SMILES | [H][C@]12[C@H](O)C[C@@H](C(C)C)[C@]1(CO)CC[C@]1(C)[C@]2(C)CC=C2[C@@]1([H])[C@@H](O)C[C@@]1([H])C(C)(C)C(=O)C(O)=C[C@]21C |
| InChI | InChI=1S/C30H46O5/c1-16(2)18-12-20(33)24-29(7)9-8-17-23(28(29,6)10-11-30(18,24)15-31)19(32)13-22-26(3,4)25(35)21(34)14-27(17,22)5/h8,14,16,18-20,22-24,31-34H,9-13,15H2,1-7H3/t18-,19-,20+,22-,23-,24+,27+,28-,29+,30+/m0/s1 |
| InChIKey | UHUNEDUYMMOJKF-MGCRBRERSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rubia yunnanensis (IPNI:765385-1) | root (BTO:0001188) | PubMed (21973054) | Methanolic extract of air dried powdered roots. |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxyrubiarbonone E (CHEBI:69506) has role metabolite (CHEBI:25212) |
| 2-hydroxyrubiarbonone E (CHEBI:69506) has role plant metabolite (CHEBI:76924) |
| 2-hydroxyrubiarbonone E (CHEBI:69506) is a cyclic terpene ketone (CHEBI:36130) |
| 2-hydroxyrubiarbonone E (CHEBI:69506) is a enol (CHEBI:33823) |
| 2-hydroxyrubiarbonone E (CHEBI:69506) is a enone (CHEBI:51689) |
| 2-hydroxyrubiarbonone E (CHEBI:69506) is a pentacyclic triterpenoid (CHEBI:25872) |
| 2-hydroxyrubiarbonone E (CHEBI:69506) is a tetrol (CHEBI:33573) |
| IUPAC Name |
|---|
| (1R,3S,3aR,5aS,5bS,6S,7aR,11aR,13aR,13bR)-1,6,10-trihydroxy-3a-(hydroxymethyl)-5a,8,8,11a,13a-pentamethyl-3-(propan-2-yl)-1,2,3,3a,4,5,5a,5b,6,7,7a,8,11a,13,13a,13b-hexadecahydro-9H-cyclopenta[a]chrysen-9-one |
| Synonym | Source |
|---|---|
| 2,7β,19α,28-tetrahydroxyarbor-1,9(11)-dien-3-one | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22020817 | Reaxys |
| Citations |
|---|