EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H48O5 |
| Net Charge | 0 |
| Average Mass | 488.709 |
| Monoisotopic Mass | 488.35017 |
| SMILES | [H][C@]12[C@H](O)C[C@@H](C(C)C)[C@]1(CO)CC[C@@]1(C)C3=C([C@H](O)C[C@]21C)[C@@]1(C)CC[C@H](O)C(C)(C)[C@]1([H])CC3=O |
| InChI | InChI=1S/C30H48O5/c1-16(2)17-12-19(33)25-29(7)14-20(34)23-24(28(29,6)10-11-30(17,25)15-31)18(32)13-21-26(3,4)22(35)8-9-27(21,23)5/h16-17,19-22,25,31,33-35H,8-15H2,1-7H3/t17-,19+,20+,21-,22-,25+,27-,28-,29+,30+/m0/s1 |
| InChIKey | HJCQEFXCUBGQOE-RWPYJWJNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rubia yunnanensis (IPNI:765385-1) | root (BTO:0001188) | PubMed (21973054) | Methanolic extract of air dried powdered roots. |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rubiyunnanol C (CHEBI:69504) has role metabolite (CHEBI:25212) |
| rubiyunnanol C (CHEBI:69504) has role plant metabolite (CHEBI:76924) |
| rubiyunnanol C (CHEBI:69504) is a cyclic terpene ketone (CHEBI:36130) |
| rubiyunnanol C (CHEBI:69504) is a pentacyclic triterpenoid (CHEBI:25872) |
| rubiyunnanol C (CHEBI:69504) is a tetrol (CHEBI:33573) |
| IUPAC Name |
|---|
| (1R,3S,3aR,5aR,7aR,9S,11aS,12R,13aR,13bR)-1,9,12-trihydroxy-3a-(hydroxymethyl)-5a,8,8,11a,13a-pentamethyl-3-(propan-2-yl)-1,2,3,3a,4,5,5a,7,7a,8,9,10,11,11a,12,13,13a,13b-octadecahydro-6H-cyclopenta[a]chrysen-6-one |
| Synonym | Source |
|---|---|
| 3β,11α,19α,28-tetrahydroxyarbor-8-en-7-one | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22020820 | Reaxys |
| Citations |
|---|