EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H48O2 |
| Net Charge | 0 |
| Average Mass | 440.712 |
| Monoisotopic Mass | 440.36543 |
| SMILES | [H][C@@]12C(=CC[C@]3(C)C4=CC[C@@H](C(C)C)[C@]4(C)CC[C@@]13C)[C@@]1(C)CC[C@H](O)C(C)(C)[C@]1([H])C[C@@H]2O |
| InChI | InChI=1S/C30H48O2/c1-18(2)19-9-10-22-28(19,6)15-16-30(8)25-20(11-14-29(22,30)7)27(5)13-12-24(32)26(3,4)23(27)17-21(25)31/h10-11,18-19,21,23-25,31-32H,9,12-17H2,1-8H3/t19-,21-,23-,24-,25-,27+,28-,29+,30-/m0/s1 |
| InChIKey | DZVKARMRCYPKBK-CUOZZFPSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rubia yunnanensis (IPNI:765385-1) | root (BTO:0001188) | PubMed (21973054) | Methanolic extract of air dried powdered roots. |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rubiyunnanol B (CHEBI:69502) has role antineoplastic agent (CHEBI:35610) |
| rubiyunnanol B (CHEBI:69502) has role metabolite (CHEBI:25212) |
| rubiyunnanol B (CHEBI:69502) has role plant metabolite (CHEBI:76924) |
| rubiyunnanol B (CHEBI:69502) is a diol (CHEBI:23824) |
| rubiyunnanol B (CHEBI:69502) is a pentacyclic triterpenoid (CHEBI:25872) |
| IUPAC Name |
|---|
| (3S,3aS,5aS,5bS,6S,7aR,9S,11aS,13aS)-3a,5a,8,8,11a,13a-hexamethyl-3-(propan-2-yl)-3,3a,4,5,5a,5b,6,7,7a,8,9,10,11,11a,13,13a-hexadecahydro-2H-cyclopenta[a]chrysene-6,9-diol |
| Synonym | Source |
|---|---|
| 3β,7β-dihydroxyarbor-9(11),18-diene | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22020810 | Reaxys |
| Citations |
|---|