EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H48O2 |
| Net Charge | 0 |
| Average Mass | 440.712 |
| Monoisotopic Mass | 440.36543 |
| SMILES | [H][C@]12[C@H](O)C[C@@H](C(C)C)[C@]1(C)CC[C@@]1(C)C3=CC[C@@]4([H])C(C)(C)[C@@H](O)CC[C@]4(C)C3=CC[C@]21C |
| InChI | InChI=1S/C30H48O2/c1-18(2)21-17-22(31)25-28(21,6)15-16-29(7)20-9-10-23-26(3,4)24(32)12-13-27(23,5)19(20)11-14-30(25,29)8/h9,11,18,21-25,31-32H,10,12-17H2,1-8H3/t21-,22+,23-,24-,25-,27+,28-,29-,30+/m0/s1 |
| InChIKey | VGCPCEYHYXKGCA-ZMTMDZEFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rubia yunnanensis (IPNI:765385-1) | root (BTO:0001188) | PubMed (21973054) | Methanolic extract of air dried powdered roots. |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rubiyunnanol A (CHEBI:69501) has role antineoplastic agent (CHEBI:35610) |
| rubiyunnanol A (CHEBI:69501) has role metabolite (CHEBI:25212) |
| rubiyunnanol A (CHEBI:69501) has role plant metabolite (CHEBI:76924) |
| rubiyunnanol A (CHEBI:69501) is a diol (CHEBI:23824) |
| rubiyunnanol A (CHEBI:69501) is a pentacyclic triterpenoid (CHEBI:25872) |
| IUPAC Name |
|---|
| (1R,3S,3aS,5aR,7aR,9S,11aS,13aR,13bS)-3a,5a,8,8,11a,13a-hexamethyl-3-(propan-2-yl)-2,3,3a,4,5,5a,7,7a,8,9,10,11,11a,13,13a,13b-hexadecahydro-1H-cyclopenta[a]chrysene-1,9-diol |
| Synonym | Source |
|---|---|
| 3β,19α-dihydroxyarbor-7,9(11)-diene | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22020811 | Reaxys |
| Citations |
|---|