EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H16O9 |
| Net Charge | 0 |
| Average Mass | 328.273 |
| Monoisotopic Mass | 328.07943 |
| SMILES | [H][C@@]12O[C@H](CO)[C@@H](O)[C@H](O)[C@@]1([H])OC(=O)c1cc(O)c(OC)c(O)c12 |
| InChI | InChI=1S/C14H16O9/c1-21-11-5(16)2-4-7(9(11)18)12-13(23-14(4)20)10(19)8(17)6(3-15)22-12/h2,6,8,10,12-13,15-19H,3H2,1H3/t6-,8-,10+,12+,13-/m1/s1 |
| InChIKey | YWJXCIXBAKGUKZ-HJJNZUOJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cenostigma gardnerianum (ncbitaxon:397175) | stem (BTO:0001300) | PubMed (21939182) | Previous component: stem bark; |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Bergenin (CHEBI:69499) has role metabolite (CHEBI:25212) |
| Bergenin (CHEBI:69499) is a trihydroxybenzoic acid (CHEBI:27115) |
| Synonyms | Source |
|---|---|
| (2R,3S,4S,4aR,10bS)-3,4,8,10-Tetrahydroxy-2-(hydroxymethyl)-9-methoxy-3,4,4a,10b-tetrahydropyrano[3,2-c]isochromen-6(2H)-one | ChEBI |
| Bergenin | KEGG COMPOUND |
| Bergeninum | ChEMBL |
| Cuscutin | ChEBI |
| NSC-661749 | ChEMBL |
| NSC-757796 | ChEMBL |
| Citations |
|---|