EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O4 |
| Net Charge | 0 |
| Average Mass | 336.472 |
| Monoisotopic Mass | 336.23006 |
| SMILES | [H][C@@]12[C@@H](O)[C@@H](O)C3=C[C@@](C)(C=C)CC[C@]3(O)[C@@]1(C)[C@H](O)CCC2(C)C |
| InChI | InChI=1S/C20H32O4/c1-6-18(4)9-10-20(24)12(11-18)14(22)15(23)16-17(2,3)8-7-13(21)19(16,20)5/h6,11,13-16,21-24H,1,7-10H2,2-5H3/t13-,14+,15+,16+,18+,19+,20-/m1/s1 |
| InChIKey | MDMNBGISPKQWRE-KNEKMNIZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Smardaea (ncbitaxon:173111) | - | PubMed (21999655) | Ethyl acetate extract,Endophytic fungus in the living photosynthetic tissue of Ceratodon purpureus. Strain: AZ0432 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Sphaeropsidin F (CHEBI:69498) has role metabolite (CHEBI:25212) |
| Sphaeropsidin F (CHEBI:69498) is a tricyclic diterpenoid (CHEBI:79084) |
| Synonym | Source |
|---|---|
| (1beta,6alpha,7alpha,13alpha)-Pimara-8(14),15-diene-1,6,7,9-tetrol | ChEBI |
| Citations |
|---|