EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H26O6 |
| Net Charge | 0 |
| Average Mass | 362.422 |
| Monoisotopic Mass | 362.17294 |
| SMILES | [H][C@]12C(C)(C)CCC[C@@]13C(=O)O[C@]2(O)C(=O)C1=C[C@@](C)(C=C)C[C@@H](O)[C@@]13O |
| InChI | InChI=1S/C20H26O6/c1-5-17(4)9-11-13(22)20(25)14-16(2,3)7-6-8-18(14,15(23)26-20)19(11,24)12(21)10-17/h5,9,12,14,21,24-25H,1,6-8,10H2,2-4H3/t12-,14+,17-,18+,19+,20-/m1/s1 |
| InChIKey | RGMZNUAVQHIGNL-WSFBEDDRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Smardaea (ncbitaxon:173111) | - | PubMed (21999655) | Ethyl acetate extract,Endophytic fungus in the living photosynthetic tissue of Ceratodon purpureus. Strain: AZ0432 |
| Diplodia cupressi (ncbitaxon:400389) | - | PubMed (22124378) | Strain: 261.85CBS |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Sphaeropsidin D (CHEBI:69496) has role metabolite (CHEBI:25212) |
| Sphaeropsidin D (CHEBI:69496) is a γ-lactone (CHEBI:37581) |
| Synonym | Source |
|---|---|
| 9alpha,11alpha-dihydroxy-7-oxopimara-8(14),15-dien-20-oic acid 6,20-lactone | ChEBI |
| Citations |
|---|