EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28O4 |
| Net Charge | 0 |
| Average Mass | 332.440 |
| Monoisotopic Mass | 332.19876 |
| SMILES | [H][C@@]12CC(=O)C3=C[C@@](C)(C=C)CC[C@]3(O)[C@@]1(C(=O)O)CCCC2(C)C |
| InChI | InChI=1S/C20H28O4/c1-5-18(4)9-10-20(24)13(12-18)14(21)11-15-17(2,3)7-6-8-19(15,20)16(22)23/h5,12,15,24H,1,6-11H2,2-4H3,(H,22,23)/t15-,18-,19-,20+/m0/s1 |
| InChIKey | VIDNIVWPSMVGJV-MVJPYGJCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Diplodia cupressi (ncbitaxon:400389) | - | PubMed (22124378) | Strain: 261.85CBS |
| Smardaea (ncbitaxon:173111) | - | PubMed (21999655) | Ethyl acetate extract,Endophytic fungus in the living photosynthetic tissue of Ceratodon purpureus. Strain: AZ0432 |
| Xylaria (ncbitaxon:37991) | - | PubMed (21226484) | Ethyl acetate extract of broth, fungus isolated from an undefined dead wood Strain: BCC 4297 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Sphaeropsidin C (CHEBI:69495) has role metabolite (CHEBI:25212) |
| Sphaeropsidin C (CHEBI:69495) is a tricyclic diterpenoid (CHEBI:79084) |
| Synonym | Source |
|---|---|
| (13alpha)-9-Hydroxy-7-oxopimara-8(14),15-dien-20-oic acid | ChEBI |
| Citations |
|---|