EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H28O4 |
| Net Charge | 0 |
| Average Mass | 320.429 |
| Monoisotopic Mass | 320.19876 |
| SMILES | C=C[C@@]1(C)CC[C@]2(O)C3=C(C(=O)[C@H](O)[C@]2(O)C1)C(C)(C)CCC3 |
| InChI | InChI=1S/C19H28O4/c1-5-17(4)9-10-18(22)12-7-6-8-16(2,3)13(12)14(20)15(21)19(18,23)11-17/h5,15,21-23H,1,6-11H2,2-4H3/t15-,17-,18-,19+/m0/s1 |
| InChIKey | SLJLRTXXPOAPDF-DSLXNQLJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Smardaea (ncbitaxon:173111) | - | PubMed (21999655) | Ethyl acetate extract,Endophytic fungus in the living photosynthetic tissue of Ceratodon purpureus. Strain: AZ0432 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Smardaesidin F (CHEBI:69492) has role metabolite (CHEBI:25212) |
| Smardaesidin F (CHEBI:69492) is a tricyclic diterpenoid (CHEBI:79084) |
| Synonym | Source |
|---|---|
| 7beta,8alpha,9alpha-trihydroxy-20-norisopimara-5(10),15-dien-6-one | ChEBI |
| Citations |
|---|