EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28O5 |
| Net Charge | 0 |
| Average Mass | 348.439 |
| Monoisotopic Mass | 348.19367 |
| SMILES | [H][C@@]12[C@@H]3OC(=O)[C@@]1(CCCC2(C)C)[C@@]1(O)C[C@H](O)[C@](C)(C=C)C=C1[C@@H]3O |
| InChI | InChI=1S/C20H28O5/c1-5-18(4)9-11-13(22)14-15-17(2,3)7-6-8-19(15,16(23)25-14)20(11,24)10-12(18)21/h5,9,12-15,21-22,24H,1,6-8,10H2,2-4H3/t12-,13-,14+,15-,18+,19-,20+/m0/s1 |
| InChIKey | GMBCLCQVLOXAGM-JFNPQPDZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Smardaea (ncbitaxon:173111) | - | PubMed (21999655) | Ethyl acetate extract,Endophytic fungus in the living photosynthetic tissue of Ceratodon purpureus. Strain: AZ0432 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Smardaesidin E, (rel)- (CHEBI:69491) has role metabolite (CHEBI:25212) |
| Smardaesidin E, (rel)- (CHEBI:69491) is a γ-lactone (CHEBI:37581) |
| Synonym | Source |
|---|---|
| rel-7alpha,9alpha,12alpha-trihydroxy-6beta,20-epoxyisopimara-8(14),15-dien-20-one | ChEBI |
| Citations |
|---|