EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O4 |
| Net Charge | 0 |
| Average Mass | 334.456 |
| Monoisotopic Mass | 334.21441 |
| SMILES | [H][C@@]12CC(=O)C3=C[C@@](C)(C=C)CC[C@]3(O)[C@@]1(C)[C@H](O)C[C@H](O)C2(C)C |
| InChI | InChI=1S/C20H30O4/c1-6-18(4)7-8-20(24)12(11-18)13(21)9-14-17(2,3)15(22)10-16(23)19(14,20)5/h6,11,14-16,22-24H,1,7-10H2,2-5H3/t14-,15-,16+,18-,19+,20+/m0/s1 |
| InChIKey | ZTWPAGAVIFLSKK-LOBZHTCKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Smardaea (ncbitaxon:173111) | - | PubMed (21999655) | Ethyl acetate extract,Endophytic fungus in the living photosynthetic tissue of Ceratodon purpureus. Strain: AZ0432 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Smardaesidin D (CHEBI:69490) has role metabolite (CHEBI:25212) |
| Smardaesidin D (CHEBI:69490) is a tricyclic diterpenoid (CHEBI:79084) |
| Synonym | Source |
|---|---|
| 1beta,3beta,9alpha-trihydroxyisopimara-8(14),15-dien-7-one | ChEBI |
| Citations |
|---|