EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28O6 |
| Net Charge | 0 |
| Average Mass | 364.438 |
| Monoisotopic Mass | 364.18859 |
| SMILES | [H][C@]12[C@H](CO)[C@@]1(C)CC[C@]1(O)[C@@]34CCCC(C)(C)[C@]3([H])C(=O)[C@H](O)[C@]12OC4=O |
| InChI | InChI=1S/C20H28O6/c1-16(2)5-4-6-18-13(16)11(22)14(23)20(26-15(18)24)12-10(9-21)17(12,3)7-8-19(18,20)25/h10,12-14,21,23,25H,4-9H2,1-3H3/t10-,12-,13-,14-,17+,18-,19-,20-/m0/s1 |
| InChIKey | GKARPIJLSMMCSR-ZSPSABHSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Smardaea (ncbitaxon:173111) | - | PubMed (21999655) | 1.Inseparable mixture of Smardaesidin B and C2.Endophytic fungus living in Ceratodon purpureus Strain: AZ0432 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Smardaesidin A, (rel)- (CHEBI:69487) has role metabolite (CHEBI:25212) |
| Smardaesidin A, (rel)- (CHEBI:69487) is a γ-lactone (CHEBI:37581) |
| Synonym | Source |
|---|---|
| rel-7beta,9alpha,16-trihydroxy-8beta,20-epoxy-14alpha,15beta-cycloisopimara-6,20-dione | ChEBI |
| Citations |
|---|