EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H16O6 |
| Net Charge | 0 |
| Average Mass | 328.320 |
| Monoisotopic Mass | 328.09469 |
| SMILES | CC(=O)c1ccc(OC2Cc3c(ccc(C(C)=O)c3O)O2)cc1O |
| InChI | InChI=1S/C18H16O6/c1-9(19)12-4-3-11(7-15(12)21)23-17-8-14-16(24-17)6-5-13(10(2)20)18(14)22/h3-7,17,21-22H,8H2,1-2H3 |
| InChIKey | HNNFEKOVKSPWLT-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ganoderma tsugae (ncbitaxon:34467) | fruit body (BTO:0000487) | PubMed (21939217) | (+)-Ganodone was found in extracts of specimens XRI3227, a parasitic and mature specimen and XRI3228 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-Ganodone (CHEBI:69486) has role metabolite (CHEBI:25212) |
| (+)-Ganodone (CHEBI:69486) is a benzofurans (CHEBI:35259) |
| Citations |
|---|