EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H37N3O7S3 |
| Net Charge | 0 |
| Average Mass | 563.764 |
| Monoisotopic Mass | 563.17936 |
| SMILES | [H][C@]1([C@@H](C)CC)NC(=O)[C@H]2CSSCC/C=C/[C@H](CC(=O)N[C@H](CCS(C)=O)C(=O)N2)OC(=O)C[C@@H]1O |
| InChI | InChI=1S/C23H37N3O7S3/c1-4-14(2)21-18(27)12-20(29)33-15-7-5-6-9-34-35-13-17(23(31)26-21)25-22(30)16(8-10-36(3)32)24-19(28)11-15/h5,7,14-18,21,27H,4,6,8-13H2,1-3H3,(H,24,28)(H,25,30)(H,26,31)/b7-5+/t14-,15+,16+,17+,18-,21+,36?/m0/s1 |
| InChIKey | DISXKJJDDVRQSD-KLMIADJASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Burkholderia thailandensis E264 (ncbitaxon:271848) | - | PubMed (21967146) | Ethyl acetate extract |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Spiruchostatin C (CHEBI:69485) has role metabolite (CHEBI:25212) |
| Spiruchostatin C (CHEBI:69485) is a cyclodepsipeptide (CHEBI:35213) |
| Spiruchostatin C (CHEBI:69485) is a spiruchostatin (CHEBI:90234) |
| Synonym | Source |
|---|---|
| (1S,5S,6R,9S,15E,20R)-6-[(2S)-2-Butanyl]-5-hydroxy-20-[2-(methylsulfinyl)ethyl]-2-oxa-11,12-dithia-7,19,22-triazabicyclo[7.7.6]docos-15-ene-3,8,18,21-tetrone | ChEBI |
| Citations |
|---|