EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H41N |
| Net Charge | 0 |
| Average Mass | 307.566 |
| Monoisotopic Mass | 307.32390 |
| SMILES | CCCCCCCCCCCCCCCC1=NC(C)CCC1 |
| InChI | InChI=1S/C21H41N/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-18-21-19-16-17-20(2)22-21/h20H,3-19H2,1-2H3 |
| InChIKey | YMZAXCVACZXRMD-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Solenopsis invicta (ncbitaxon:13686) | - | PubMed (21905650) | Present in venome of red imported fire ant Solenopsis invicta |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-methyl-6-pentadecyl-2,3,4,5-tetrahydropyridine (CHEBI:69480) has role metabolite (CHEBI:25212) |
| 2-methyl-6-pentadecyl-2,3,4,5-tetrahydropyridine (CHEBI:69480) is a tetrahydropyridine (CHEBI:26921) |
| Citations |
|---|