EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H40O2 |
| Net Charge | 0 |
| Average Mass | 384.604 |
| Monoisotopic Mass | 384.30283 |
| SMILES | CCCCCc1cc(O)c(C/C=C(\C)CC/C=C(\C)CCC=C(C)C)c(O)c1 |
| InChI | InChI=1S/C26H40O2/c1-6-7-8-15-23-18-25(27)24(26(28)19-23)17-16-22(5)14-10-13-21(4)12-9-11-20(2)3/h11,13,16,18-19,27-28H,6-10,12,14-15,17H2,1-5H3/b21-13+,22-16+ |
| InChIKey | WYEFRBILENQYOH-CZHHEZJISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cannabis sativa (ncbitaxon:3483) | aerial part (BTO:0001658) | PubMed (21902175) | Acetone extract of Dried, powdered and heated flowered aerial parts |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sesquicannabigerol (CHEBI:69479) has role metabolite (CHEBI:25212) |
| sesquicannabigerol (CHEBI:69479) is a sesquiterpenoid (CHEBI:26658) |
| Synonym | Source |
|---|---|
| 5-Pentyl-2-[(2E,6E)-3,7,11-trimethyl-2,6,10-dodecatrien-1-yl]-1,3-benzenediol | ChEBI |
| Citations |
|---|