EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H30O2 |
| Net Charge | 0 |
| Average Mass | 314.469 |
| Monoisotopic Mass | 314.22458 |
| SMILES | [H][C@@]1(C(=C)C)CCC(C)=C[C@H]1c1c(O)cc(CCCCC)cc1O |
| InChI | InChI=1S/C21H30O2/c1-5-6-7-8-16-12-19(22)21(20(23)13-16)18-11-15(4)9-10-17(18)14(2)3/h11-13,17-18,22-23H,2,5-10H2,1,3-4H3/t17-,18+/m0/s1 |
| InChIKey | QHMBSVQNZZTUGM-ZWKOTPCHSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cannabis sativa (ncbitaxon:3483) | aerial part (BTO:0001658) | PubMed (21902175) | Acetone extract of Dried, powdered and heated flowered aerial parts |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. cannabinoid receptor agonist An agonist that binds to and activates cannabinoid receptors. cannabinoid receptor agonist An agonist that binds to and activates cannabinoid receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cannabidiol (CHEBI:69478) has role antimicrobial agent (CHEBI:33281) |
| cannabidiol (CHEBI:69478) has role plant metabolite (CHEBI:76924) |
| cannabidiol (CHEBI:69478) is a olefinic compound (CHEBI:78840) |
| cannabidiol (CHEBI:69478) is a phytocannabinoid (CHEBI:67196) |
| cannabidiol (CHEBI:69478) is a resorcinols (CHEBI:33572) |
| Incoming Relation(s) |
| hydroxy-cannabidiol (CHEBI:133048) has functional parent cannabidiol (CHEBI:69478) |
| IUPAC Name |
|---|
| (1'R,2'R)-5'-methyl-4-pentyl-2'-(prop-1-en-2-yl)-1',2',3',4'-tetrahydrobiphenyl-2,6-diol |
| INNs | Source |
|---|---|
| cannabidiol | WHO MedNet |
| cannabidiol | WHO MedNet |
| cannabidiol | WHO MedNet |
| cannabidiolum | WHO MedNet |
| Synonyms | Source |
|---|---|
| (−)-cannabidiol | ChemIDplus |
| (−)-CBD | ChemIDplus |
| (−)-trans-2-p-mentha-1,8-dien-3-yl-5-pentylresorcinol | ChemIDplus |
| (−)-trans-cannabidiol | ChemIDplus |
| Δ1(2)-trans-cannabidiol | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 5288 | DrugCentral |
| C00002641 | KNApSAcK |
| C07578 | KEGG COMPOUND |
| Cannabidiol | Wikipedia |
| CPD-7173 | MetaCyc |
| DB09061 | DrugBank |
| LMPK13120001 | LIPID MAPS |
| P0T | PDBeChem |
| US2304669 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2222023 | Reaxys |
| CAS:13956-29-1 | NIST Chemistry WebBook |
| CAS:13956-29-1 | ChemIDplus |
| CAS:13956-29-1 | KEGG COMPOUND |
| Citations |
|---|