EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:69477 - cannabigerol
| Formula | C21H32O2 |
| Net Charge | 0 |
| Average Mass | 316.485 |
| Monoisotopic Mass | 316.24023 |
| SMILES | CCCCCc1cc(O)c(C/C=C(\C)CCC=C(C)C)c(O)c1 |
| InChI | InChI=1S/C21H32O2/c1-5-6-7-11-18-14-20(22)19(21(23)15-18)13-12-17(4)10-8-9-16(2)3/h9,12,14-15,22-23H,5-8,10-11,13H2,1-4H3/b17-12+ |
| InChIKey | QXACEHWTBCFNSA-SFQUDFHCSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cannabis sativa (ncbitaxon:3483) | aerial part (BTO:0001658) | PubMed (21902175) | Acetone extract of dried, powdered and heated flowered aerial parts |
| Helichrysum (ncbitaxon:59430) | - | PubMed (21902175) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. cannabinoid receptor agonist An agonist that binds to and activates cannabinoid receptors. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. cannabinoid receptor agonist An agonist that binds to and activates cannabinoid receptors. cannabinoid receptor agonist An agonist that binds to and activates cannabinoid receptors. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. appetite enhancer A drug which increases appetite. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cannabigerol (CHEBI:69477) has role anti-inflammatory agent (CHEBI:67079) |
| cannabigerol (CHEBI:69477) has role antibacterial agent (CHEBI:33282) |
| cannabigerol (CHEBI:69477) has role antioxidant (CHEBI:22586) |
| cannabigerol (CHEBI:69477) has role appetite enhancer (CHEBI:50779) |
| cannabigerol (CHEBI:69477) has role cannabinoid receptor agonist (CHEBI:67072) |
| cannabigerol (CHEBI:69477) has role neuroprotective agent (CHEBI:63726) |
| cannabigerol (CHEBI:69477) has role plant metabolite (CHEBI:76924) |
| cannabigerol (CHEBI:69477) is a phytocannabinoid (CHEBI:67196) |
| cannabigerol (CHEBI:69477) is a resorcinols (CHEBI:33572) |
| IUPAC Name |
|---|
| 2-[(2E)-3,7-dimethylocta-2,6-dien-1-yl]-5-pentylbenzene-1,3-diol |
| Synonyms | Source |
|---|---|
| (E)-2-(3,7-dimethyl-2,6-octadienyl)-5-pentyl-1,3-benzenediol | ChemIDplus |
| (E)-2-(3,7-dimethyl-2,6-octadienyl)-5-pentyl-resorcinol | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| C20219 | KEGG COMPOUND |
| Cannabigerol | Wikipedia |
| DB14734 | DrugBank |
| EP2175848 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:25654-31-3 | ChemIDplus |
| CAS:2808-33-5 | NIST Chemistry WebBook |
| Citations |
|---|