EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H10O7 |
| Net Charge | 0 |
| Average Mass | 302.238 |
| Monoisotopic Mass | 302.04265 |
| SMILES | O=Cc1cc(C(=O)O)cc(O)c1C(=O)c1c(O)cccc1O |
| InChI | InChI=1S/C15H10O7/c16-6-8-4-7(15(21)22)5-11(19)12(8)14(20)13-9(17)2-1-3-10(13)18/h1-6,17-19H,(H,21,22) |
| InChIKey | INVAPAXTQZQLGN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium purpurogenum (ncbitaxon:28575) | mycelium (BTO:0001436) | PubMed (21879714) | Ethylacetate extract of fermentation broth and acetone extract of mycelia Strain: JS03 21 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | EC 1.14.14.14 (aromatase) inhibitor An EC 1.14.14.* (oxidoreductase acting on paired donors, incorporating of 1 atom of oxygen, with reduced flavin or flavoprotein as one donor) inhibitor which interferes with the action of aromatase (EC 1.14.14.14) and so reduces production of estrogenic steroid hormones. Penicillium metabolite Any fungal metabolite produced during a metabolic reaction in Penicillium. antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| TAN-931 (CHEBI:69475) has role Penicillium metabolite (CHEBI:76964) |
| TAN-931 (CHEBI:69475) has role antiviral agent (CHEBI:22587) |
| TAN-931 (CHEBI:69475) has role EC 1.14.14.14 (aromatase) inhibitor (CHEBI:50790) |
| TAN-931 (CHEBI:69475) is a benzaldehydes (CHEBI:22698) |
| TAN-931 (CHEBI:69475) is a benzoic acids (CHEBI:22723) |
| TAN-931 (CHEBI:69475) is a benzophenones (CHEBI:22726) |
| TAN-931 (CHEBI:69475) is a resorcinols (CHEBI:33572) |
| IUPAC Name |
|---|
| 4-(2,6-dihydroxybenzoyl)-3-formyl-5-hydroxybenzoic acid |
| Synonym | Source |
|---|---|
| Tan 931 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| EP0342665 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21878450 | Reaxys |
| CAS:127448-92-4 | ChemIDplus |
| Citations |
|---|