EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H8O5 |
| Net Charge | 0 |
| Average Mass | 220.180 |
| Monoisotopic Mass | 220.03717 |
| SMILES | CC1=C(O)C(=O)c2cc(O)c(O)cc2C1=O |
| InChI | InChI=1S/C11H8O5/c1-4-9(14)5-2-7(12)8(13)3-6(5)11(16)10(4)15/h2-3,12-13,15H,1H3 |
| InChIKey | NFPCJUXQJHJTIF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium purpurogenum (ncbitaxon:28575) | mycelium (BTO:0001436) | PubMed (21879714) | Ethylacetate extract of fermentation broth and acetone extract of mycelia Strain: JS03 21 |
| Roles Classification |
|---|
| Biological Role: | Penicillium metabolite Any fungal metabolite produced during a metabolic reaction in Penicillium. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,6,7-trihydroxy-3-methylnaphthalene-1,4-dione (CHEBI:69474) has role Penicillium metabolite (CHEBI:76964) |
| 2,6,7-trihydroxy-3-methylnaphthalene-1,4-dione (CHEBI:69474) is a hydroxy-1,4-naphthoquinone (CHEBI:132157) |
| 2,6,7-trihydroxy-3-methylnaphthalene-1,4-dione (CHEBI:69474) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 2,6,7-trihydroxy-3-methylnaphthalene-1,4-dione |
| Manual Xrefs | Databases |
|---|---|
| 26617211 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21878449 | Reaxys |
| Citations |
|---|