EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H16O5 |
| Net Charge | 0 |
| Average Mass | 252.266 |
| Monoisotopic Mass | 252.09977 |
| SMILES | CCC[C@]1(OC)OC(=O)c2c1cc(O)c(O)c2C |
| InChI | InChI=1S/C13H16O5/c1-4-5-13(17-3)8-6-9(14)11(15)7(2)10(8)12(16)18-13/h6,14-15H,4-5H2,1-3H3/t13-/m0/s1 |
| InChIKey | CHYNVNQRYJSKBG-ZDUSSCGKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium purpurogenum (ncbitaxon:28575) | mycelium (BTO:0001436) | PubMed (21879714) | Ethylacetate extract of fermentation broth and acetone extract of mycelia Strain: JS03 21 |
| Roles Classification |
|---|
| Biological Roles: | Penicillium metabolite Any fungal metabolite produced during a metabolic reaction in Penicillium. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| purpurester A (CHEBI:69472) has role Penicillium metabolite (CHEBI:76964) |
| purpurester A (CHEBI:69472) has role antiviral agent (CHEBI:22587) |
| purpurester A (CHEBI:69472) has role metabolite (CHEBI:25212) |
| purpurester A (CHEBI:69472) is a 2-benzofurans (CHEBI:38831) |
| purpurester A (CHEBI:69472) is a catechols (CHEBI:33566) |
| purpurester A (CHEBI:69472) is a ether (CHEBI:25698) |
| purpurester A (CHEBI:69472) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (3S)-5,6-dihydroxy-3-methoxy-7-methyl-3-propyl-2-benzofuran-1(3H)-one |
| Synonym | Source |
|---|---|
| (S)-5,6-dihydroxy-3-methoxy-7-methyl-3-propylisobenzofuran-1(3H)-one | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21878448 | Reaxys |
| Citations |
|---|