EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H16O5 |
| Net Charge | 0 |
| Average Mass | 252.266 |
| Monoisotopic Mass | 252.09977 |
| SMILES | CCC[C@]1(OC)OC(=O)c2c1cc(O)c(O)c2C |
| InChI | InChI=1S/C13H16O5/c1-4-5-13(17-3)8-6-9(14)11(15)7(2)10(8)12(16)18-13/h6,14-15H,4-5H2,1-3H3/t13-/m0/s1 |
| InChIKey | CHYNVNQRYJSKBG-ZDUSSCGKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium purpurogenum (ncbitaxon:28575) | mycelium (BTO:0001436) | PubMed (21879714) | Ethylacetate extract of fermentation broth and acetone extract of mycelia Strain: JS03 21 |
| Roles Classification |
|---|
| Biological Roles: | antiviral agent A substance that destroys or inhibits replication of viruses. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. Penicillium metabolite Any fungal metabolite produced during a metabolic reaction in Penicillium. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| purpurester A (CHEBI:69472) has role Penicillium metabolite (CHEBI:76964) |
| purpurester A (CHEBI:69472) has role antiviral agent (CHEBI:22587) |
| purpurester A (CHEBI:69472) has role metabolite (CHEBI:25212) |
| purpurester A (CHEBI:69472) is a 2-benzofurans (CHEBI:38831) |
| purpurester A (CHEBI:69472) is a catechols (CHEBI:33566) |
| purpurester A (CHEBI:69472) is a ether (CHEBI:25698) |
| purpurester A (CHEBI:69472) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (3S)-5,6-dihydroxy-3-methoxy-7-methyl-3-propyl-2-benzofuran-1(3H)-one |
| Synonym | Source |
|---|---|
| (S)-5,6-dihydroxy-3-methoxy-7-methyl-3-propylisobenzofuran-1(3H)-one | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21878448 | Reaxys |
| Citations |
|---|