EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H18N2O5 |
| Net Charge | 0 |
| Average Mass | 330.340 |
| Monoisotopic Mass | 330.12157 |
| SMILES | O=C(O)C1=C/C(=C/C=N\CCc2ccc(O)cc2)CC(C(=O)O)N1 |
| InChI | InChI=1S/C17H18N2O5/c20-13-3-1-11(2-4-13)5-7-18-8-6-12-9-14(16(21)22)19-15(10-12)17(23)24/h1-4,6,8-9,15,19-20H,5,7,10H2,(H,21,22)(H,23,24)/b12-6-,18-8- |
| InChIKey | LWXJBFFPVPUUSL-JEUDWDASSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Miraxanthin-III (CHEBI:6947) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| Synonym | Source |
|---|---|
| Miraxanthin-III | KEGG COMPOUND |