EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H18O3 |
| Net Charge | 0 |
| Average Mass | 234.295 |
| Monoisotopic Mass | 234.12559 |
| SMILES | Cc1c(CCO)c(CO)cc2c1C(=O)[C@H](C)C2 |
| InChI | InChI=1S/C14H18O3/c1-8-5-10-6-11(7-16)12(3-4-15)9(2)13(10)14(8)17/h6,8,15-16H,3-5,7H2,1-2H3/t8-/m1/s1 |
| InChIKey | QDZJDGJEGHSXFF-MRVPVSSYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Acrostichum aureum (ncbitaxon:29594) | aerial part (BTO:0001658) | PubMed (21899268) | Methanolic extract of dried and pulverized aerial parts |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2R)-pterosin P (CHEBI:69468) has role metabolite (CHEBI:25212) |
| (2R)-pterosin P (CHEBI:69468) is a indanones (CHEBI:24789) |
| Citations |
|---|