EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H18O6S |
| Net Charge | 0 |
| Average Mass | 314.359 |
| Monoisotopic Mass | 314.08241 |
| SMILES | Cc1cc2c(c(C)c1CCOS(=O)(=O)O)C(=O)[C@H](C)[C@@H]2O |
| InChI | InChI=1S/C14H18O6S/c1-7-6-11-12(14(16)9(3)13(11)15)8(2)10(7)4-5-20-21(17,18)19/h6,9,13,15H,4-5H2,1-3H3,(H,17,18,19)/t9-,13+/m1/s1 |
| InChIKey | AJYKBYFVDNGNQI-RNCFNFMXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Acrostichum aureum (ncbitaxon:29594) | aerial part (BTO:0001658) | PubMed (21899268) | Methanolic extract of dried and pulverized aerial parts |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2R,3S)-sulfated pterosin C, (+)- (CHEBI:69465) has role metabolite (CHEBI:25212) |
| (2R,3S)-sulfated pterosin C, (+)- (CHEBI:69465) is a indanones (CHEBI:24789) |
| Citations |
|---|