EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H36O7 |
| Net Charge | 0 |
| Average Mass | 460.567 |
| Monoisotopic Mass | 460.24610 |
| SMILES | CC(=O)O[C@H](/C=C(\C)CC[C@@H](OC(C)=O)[C@]1(C)CCC(=O)O1)C/C(C)=C/CCc1ccoc1 |
| InChI | InChI=1S/C26H36O7/c1-18(7-6-8-22-12-14-30-17-22)15-23(31-20(3)27)16-19(2)9-10-24(32-21(4)28)26(5)13-11-25(29)33-26/h7,12,14,16-17,23-24H,6,8-11,13,15H2,1-5H3/b18-7+,19-16+/t23-,24+,26-/m0/s1 |
| InChIKey | FKFCRXIWISWTQT-NEQWESOKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ircinia (ncbitaxon:275431) | - | PubMed (21902186) | EtOAc extract of freeze-dried specimen |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| irciformonin F (CHEBI:69464) has role metabolite (CHEBI:25212) |
| irciformonin F (CHEBI:69464) is a terpene lactone (CHEBI:37668) |
| Synonym | Source |
|---|---|
| (3E,6S,7E,11R)-1-(3-Furyl)-4,8-dimethyl-11-[(2S)-2-methyl-5-oxotetrahydro-2-furanyl]-3,7-undecadiene-6,11-diyl diacetate | ChEBI |
| Citations |
|---|