EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H34O6 |
| Net Charge | 0 |
| Average Mass | 418.530 |
| Monoisotopic Mass | 418.23554 |
| SMILES | CC(=O)O[C@H](CC/C(C)=C/[C@@H](O)C/C(C)=C/CCc1ccoc1)[C@]1(C)CCC(=O)O1 |
| InChI | InChI=1S/C24H34O6/c1-17(6-5-7-20-11-13-28-16-20)14-21(26)15-18(2)8-9-22(29-19(3)25)24(4)12-10-23(27)30-24/h6,11,13,15-16,21-22,26H,5,7-10,12,14H2,1-4H3/b17-6+,18-15+/t21-,22+,24-/m0/s1 |
| InChIKey | QBMTWQFCLDXOKN-PRBWFTGVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ircinia (ncbitaxon:275431) | - | PubMed (21902186) | EtOAc extract of freeze-dried specimen |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 15-acetylirciformonin B (CHEBI:69462) has role metabolite (CHEBI:25212) |
| 15-acetylirciformonin B (CHEBI:69462) is a terpene lactone (CHEBI:37668) |
| Synonym | Source |
|---|---|
| (1R,4E,6S,8E)-11-(3-Furyl)-6-hydroxy-4,8-dimethyl-1-[(2S)-2-methyl-5-oxotetrahydro-2-furanyl]-4,8-undecadien-1-yl acetate | ChEBI |
| Citations |
|---|