EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H34O6 |
| Net Charge | 0 |
| Average Mass | 382.497 |
| Monoisotopic Mass | 382.23554 |
| SMILES | C/C(=C\[C@@H](O)C/C(C)=C/CCCC(=O)CO)CC[C@@H](O)[C@]1(C)CCC(=O)O1 |
| InChI | InChI=1S/C21H34O6/c1-15(6-4-5-7-17(23)14-22)12-18(24)13-16(2)8-9-19(25)21(3)11-10-20(26)27-21/h6,13,18-19,22,24-25H,4-5,7-12,14H2,1-3H3/b15-6+,16-13+/t18-,19+,21-/m0/s1 |
| InChIKey | YKUZFPGHZVFVLY-DZMSUEBXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ircinia (ncbitaxon:275431) | - | PubMed (21902186) | EtOAc extract of freeze-dried specimen |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ircinolin A (CHEBI:69461) has role metabolite (CHEBI:25212) |
| ircinolin A (CHEBI:69461) is a terpene lactone (CHEBI:37668) |
| Synonym | Source |
|---|---|
| (5S)-5-Methyl-5-[(1R,4E,6S,8E)-1,6,14-trihydroxy-4,8-dimethyl-13-oxo-4,8-tetradecadien-1-yl]dihydro-2(3H)-furanone | ChEBI |
| Citations |
|---|