EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H32O5 |
| Net Charge | 0 |
| Average Mass | 376.493 |
| Monoisotopic Mass | 376.22497 |
| SMILES | C/C(=C\[C@@H](O)C/C(C)=C/CCc1ccoc1)CC[C@@H](O)[C@]1(C)CCC(=O)O1 |
| InChI | InChI=1S/C22H32O5/c1-16(5-4-6-18-10-12-26-15-18)13-19(23)14-17(2)7-8-20(24)22(3)11-9-21(25)27-22/h5,10,12,14-15,19-20,23-24H,4,6-9,11,13H2,1-3H3/b16-5+,17-14+/t19-,20+,22-/m0/s1 |
| InChIKey | RUOCTYFLHGRTMP-LKYGDWGJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ircinia (ncbitaxon:275431) | - | PubMed (21902186) | EtOAc extract of freeze-dried specimen |
| Ircinia formosana (WORMS:529745) | - | PubMed (21902186) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| irciformonin B (CHEBI:69460) has role metabolite (CHEBI:25212) |
| irciformonin B (CHEBI:69460) is a terpene lactone (CHEBI:37668) |
| Synonym | Source |
|---|---|
| (5S)-5-[(1R,4E,6S,8E)-11-(furan-3-yl)-1,6-dihydroxy-4,8-dimethylundeca-4,8-dienyl]-5-methyloxolan-2-one | ChEBI |
| Citations |
|---|