EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H18O12 |
| Net Charge | 0 |
| Average Mass | 450.352 |
| Monoisotopic Mass | 450.07983 |
| SMILES | O=c1c(O[C@@H]2OC[C@@H](O)[C@H](O)[C@H]2O)c(-c2cc(O)c(O)c(O)c2)oc2cc(O)cc(O)c12 |
| InChI | InChI=1S/C20H18O12/c21-7-3-8(22)13-12(4-7)31-18(6-1-9(23)14(26)10(24)2-6)19(16(13)28)32-20-17(29)15(27)11(25)5-30-20/h1-4,11,15,17,20-27,29H,5H2/t11-,15+,17-,20+/m1/s1 |
| InChIKey | SBEOEJNITMVWLK-CFSKSFDZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mimosa diplotricha (ncbitaxon:512270) | aerial part (BTO:0001658) | PubMed (21875046) | Ethanolic extract of aerial parts |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| myricetin-3-O-β-D-xylopyranoside (CHEBI:69458) has functional parent myricetin (CHEBI:18152) |
| myricetin-3-O-β-D-xylopyranoside (CHEBI:69458) has role plant metabolite (CHEBI:76924) |
| myricetin-3-O-β-D-xylopyranoside (CHEBI:69458) is a glycosyloxyflavone (CHEBI:50018) |
| myricetin-3-O-β-D-xylopyranoside (CHEBI:69458) is a monosaccharide derivative (CHEBI:63367) |
| myricetin-3-O-β-D-xylopyranoside (CHEBI:69458) is a pentahydroxyflavone (CHEBI:25883) |
| myricetin-3-O-β-D-xylopyranoside (CHEBI:69458) is a xylose derivative (CHEBI:74865) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-4-oxo-2-(3,4,5-trihydroxyphenyl)-4H-chromen-3-yl β-D-xylopyranoside |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7697312 | Reaxys |
| Citations |
|---|