EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H14O7 |
| Net Charge | 0 |
| Average Mass | 330.292 |
| Monoisotopic Mass | 330.07395 |
| SMILES | COc1c(-c2ccc(O)c(O)c2)oc2c(OC)c(O)ccc2c1=O |
| InChI | InChI=1S/C17H14O7/c1-22-16-11(19)6-4-9-13(21)17(23-2)14(24-15(9)16)8-3-5-10(18)12(20)7-8/h3-7,18-20H,1-2H3 |
| InChIKey | LLXQONIKJLTKCF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mimosa diplotricha (ncbitaxon:512270) | aerial part (BTO:0001658) | PubMed (21875046) | Ethanolic extract of aerial part |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7,3',4'-trihydroxy-3,8-dimethoxyflavone (CHEBI:69452) has functional parent flavone (CHEBI:42491) |
| 7,3',4'-trihydroxy-3,8-dimethoxyflavone (CHEBI:69452) has role antineoplastic agent (CHEBI:35610) |
| 7,3',4'-trihydroxy-3,8-dimethoxyflavone (CHEBI:69452) has role metabolite (CHEBI:25212) |
| 7,3',4'-trihydroxy-3,8-dimethoxyflavone (CHEBI:69452) is a catechols (CHEBI:33566) |
| 7,3',4'-trihydroxy-3,8-dimethoxyflavone (CHEBI:69452) is a dimethoxyflavone (CHEBI:23798) |
| 7,3',4'-trihydroxy-3,8-dimethoxyflavone (CHEBI:69452) is a trihydroxyflavone (CHEBI:27116) |
| IUPAC Name |
|---|
| 2-(3,4-dihydroxyphenyl)-7-hydroxy-3,8-dimethoxy-4H-chromen-4-one |
| Manual Xrefs | Databases |
|---|---|
| LMPK12111608 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1329302 | Reaxys |
| Citations |
|---|