EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H22O10 |
| Net Charge | 0 |
| Average Mass | 494.452 |
| Monoisotopic Mass | 494.12130 |
| SMILES | COc1cc([C@H]2Oc3cc(-c4cc(=O)c5c(O)cc(O)cc5o4)ccc3O[C@@H]2CO)cc(OC)c1O |
| InChI | InChI=1S/C26H22O10/c1-32-21-6-13(7-22(33-2)25(21)31)26-23(11-27)34-17-4-3-12(5-19(17)36-26)18-10-16(30)24-15(29)8-14(28)9-20(24)35-18/h3-10,23,26-29,31H,11H2,1-2H3/t23-,26-/m1/s1 |
| InChIKey | XBXVVTMNRUIPIX-ZEQKJWHPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mimosa diplotricha (ncbitaxon:512270) | aerial part (BTO:0001658) | PubMed (21875046) | Ethanolic extract of aerial parts |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5''-methoxyhydnocarpin-D (CHEBI:69451) has role plant metabolite (CHEBI:76924) |
| 5''-methoxyhydnocarpin-D (CHEBI:69451) is a benzodioxine (CHEBI:64096) |
| 5''-methoxyhydnocarpin-D (CHEBI:69451) is a dimethoxybenzene (CHEBI:51681) |
| 5''-methoxyhydnocarpin-D (CHEBI:69451) is a flavonolignan (CHEBI:72709) |
| 5''-methoxyhydnocarpin-D (CHEBI:69451) is a polyphenol (CHEBI:26195) |
| Manual Xrefs | Databases |
|---|---|
| C11162 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21878434 | Reaxys |
| Citations |
|---|