EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H16O7 |
| Net Charge | 0 |
| Average Mass | 356.330 |
| Monoisotopic Mass | 356.08960 |
| SMILES | COc1ccc2c(c1O)COc1c-2oc2c(OC)c(OC)ccc2c1=O |
| InChI | InChI=1S/C19H16O7/c1-22-12-6-4-9-11(14(12)20)8-25-19-15(21)10-5-7-13(23-2)18(24-3)17(10)26-16(9)19/h4-7,20H,8H2,1-3H3 |
| InChIKey | DDMDVSWCBPTIHI-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mimosa diplotricha (ncbitaxon:512270) | aerial part (BTO:0001658) | PubMed (21875046) | Ethanolic extract of aerial part |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diplotasin (CHEBI:69450) has role plant metabolite (CHEBI:76924) |
| diplotasin (CHEBI:69450) is a aromatic ether (CHEBI:35618) |
| diplotasin (CHEBI:69450) is a hydroxy homoflavonoid (CHEBI:76405) |
| diplotasin (CHEBI:69450) is a organic heterotetracyclic compound (CHEBI:38163) |
| IUPAC Name |
|---|
| 4-hydroxy-3,10,11-trimethoxyisochromeno[4,3-b]chromen-7(5H)-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21878433 | Reaxys |
| Citations |
|---|