EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H18N2O7S |
| Net Charge | 0 |
| Average Mass | 358.372 |
| Monoisotopic Mass | 358.08347 |
| SMILES | CS(=O)CCC(/N=C\C=C1\C=C(C(=O)O)NC(C(=O)O)C1)C(=O)O |
| InChI | InChI=1S/C14H18N2O7S/c1-24(23)5-3-9(12(17)18)15-4-2-8-6-10(13(19)20)16-11(7-8)14(21)22/h2,4,6,9,11,16H,3,5,7H2,1H3,(H,17,18)(H,19,20)(H,21,22)/b8-2-,15-4- |
| InChIKey | KRWNKOCPQBHMPM-CEEUPZOTSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Miraxanthin-I (CHEBI:6945) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| Synonym | Source |
|---|---|
| Miraxanthin-I | KEGG COMPOUND |