EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H18O8 |
| Net Charge | 0 |
| Average Mass | 374.345 |
| Monoisotopic Mass | 374.10017 |
| SMILES | COc1cc(O)c(-c2oc3c(OC)c(OC)ccc3c(=O)c2OC)cc1O |
| InChI | InChI=1S/C19H18O8/c1-23-13-6-5-9-15(22)19(26-4)17(27-16(9)18(13)25-3)10-7-12(21)14(24-2)8-11(10)20/h5-8,20-21H,1-4H3 |
| InChIKey | SLQULBLJRHRPIS-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mimosa diplotricha (ncbitaxon:512270) | aerial part (BTO:0001658) | PubMed (21875046) | Ethanolic extract of aerial part |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diplotrin A (CHEBI:69447) has functional parent flavone (CHEBI:42491) |
| diplotrin A (CHEBI:69447) has role plant metabolite (CHEBI:76924) |
| diplotrin A (CHEBI:69447) is a dihydroxyflavone (CHEBI:38686) |
| diplotrin A (CHEBI:69447) is a tetramethoxyflavone (CHEBI:76875) |
| IUPAC Name |
|---|
| 2-(2,5-dihydroxy-4-methoxyphenyl)-3,7,8-trimethoxy-4H-chromen-4-one |
| Synonym | Source |
|---|---|
| 2',5'-dihydroxy-3,7,8,4'-tetramethoxyflavone | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21878432 | Reaxys |
| Citations |
|---|